C26H24F3N3O4 — CID 159408911
N-[4-methyl-3-[1-(2-methylperoxyethyl)-4-oxo-2,3-dihydroquinolin-7-yl]phenyl]-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 159408911) has the molecular formula C26H24F3N3O4 and a molecular weight of 499.49 g/mol. Its IUPAC name is N-[4-methyl-3-[1-(2-methylperoxyethyl)-4-oxo-2,3-dihydroquinolin-7-yl]phenyl]-2-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | N-[4-methyl-3-[1-(2-methylperoxyethyl)-4-oxo-2,3-dihydroquinolin-7-yl]phenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 159408911 |
| Molecular Formula | C26H24F3N3O4 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | N-[4-methyl-3-[1-(2-methylperoxyethyl)-4-oxo-2,3-dihydroquinolin-7-yl]phenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | COOCCN1CCC(=O)c2ccc(-c3cc(NC(=O)c4ccnc(C(F)(F)F)c4)ccc3C)cc21 |
| InChI | InChI=1S/C26H24F3N3O4/c1-16-3-5-19(31-25(34)18-7-9-30-24(14-18)26(27,28)29)15-21(16)17-4-6-20-22(13-17)32(10-8-23(20)33)11-12-36-35-2/h3-7,9,13-15H,8,10-12H2,1-2H3,(H,31,34) |
| InChIKey | LOIAHLGHXBXSGS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|