About 5-hydroxy-6-methylpyridine-3,4-dicarboxylic acid;hydrochloride
5-hydroxy-6-methylpyridine-3,4-dicarboxylic acid;hydrochloride (PubChem CID 159409477) has the molecular formula C8H8ClNO5
and a molecular weight of 233.61 g/mol. Its IUPAC name is 5-hydroxy-6-methylpyridine-3,4-dicarboxylic acid;hydrochloride.
Analyze 5-hydroxy-6-methylpyridine-3,4-dicarboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-6-methylpyridine-3,4-dicarboxylic acid;hydrochloride?
The IUPAC name of 5-hydroxy-6-methylpyridine-3,4-dicarboxylic acid;hydrochloride (CID 159409477) is 5-hydroxy-6-methylpyridine-3,4-dicarboxylic acid;hydrochloride.
What is the SMILES notation for 5-hydroxy-6-methylpyridine-3,4-dicarboxylic acid;hydrochloride?
The canonical SMILES for 5-hydroxy-6-methylpyridine-3,4-dicarboxylic acid;hydrochloride is Cc1ncc(C(=O)O)c(C(=O)O)c1O.Cl.
What is the InChIKey of 5-hydroxy-6-methylpyridine-3,4-dicarboxylic acid;hydrochloride?
The InChIKey is LOJUQLGDBXZQIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO5.ClH/c1-3-6(10)5(8(13)14)4(2-9-3)7(11)12;/h2,10H,1H3,(H,11,12)(H,13,14);1H.
What are the key properties of 5-hydroxy-6-methylpyridine-3,4-dicarboxylic acid;hydrochloride?
5-hydroxy-6-methylpyridine-3,4-dicarboxylic acid;hydrochloride has a molecular weight of 233.61 g/mol, XLogP of 0.91, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-6-methylpyridine-3,4-dicarboxylic acid;hydrochloride is sourced from PubChem (CID 159409477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).