C29H35N3O2 — CID 159412540
4-(4-benzyl-3-propanoylquinolin-6-yl)-N-butylpiperidine-1-carboxamide (PubChem CID 159412540) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 4-(4-benzyl-3-propanoylquinolin-6-yl)-N-butylpiperidine-1-carboxamide.
| Compound Name | 4-(4-benzyl-3-propanoylquinolin-6-yl)-N-butylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 159412540 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 4-(4-benzyl-3-propanoylquinolin-6-yl)-N-butylpiperidine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCC(c2ccc3ncc(C(=O)CC)c(Cc4ccccc4)c3c2)CC1 |
| InChI | InChI=1S/C29H35N3O2/c1-3-5-15-30-29(34)32-16-13-22(14-17-32)23-11-12-27-25(19-23)24(18-21-9-7-6-8-10-21)26(20-31-27)28(33)4-2/h6-12,19-20,22H,3-5,13-18H2,1-2H3,(H,30,34) |
| InChIKey | UNCFJSQUSLKKAE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|