C11H20O — CID 159416985
(1S,4R,6R)-4-methylbicyclo[4.1.0]heptan-3-one;propane (PubChem CID 159416985) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (1S,4R,6R)-4-methylbicyclo[4.1.0]heptan-3-one;propane.
| Compound Name | (1S,4R,6R)-4-methylbicyclo[4.1.0]heptan-3-one;propane |
|---|---|
| PubChem CID | 159416985 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (1S,4R,6R)-4-methylbicyclo[4.1.0]heptan-3-one;propane |
| SMILES | CCC.C[C@@H]1C[C@H]2C[C@H]2CC1=O |
| InChI | InChI=1S/C8H12O.C3H8/c1-5-2-6-3-7(6)4-8(5)9;1-3-2/h5-7H,2-4H2,1H3;3H2,1-2H3/t5-,6+,7+;/m1./s1 |
| InChIKey | LPGZHGYIQRLHCM-NLRFIBDTSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |