C21H19NO2 — CID 159420112
methyl 5-(2,2-diphenylethyl)pyridine-2-carboxylate (PubChem CID 159420112) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is methyl 5-(2,2-diphenylethyl)pyridine-2-carboxylate.
| Compound Name | methyl 5-(2,2-diphenylethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 159420112 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | methyl 5-(2,2-diphenylethyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(CC(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C21H19NO2/c1-24-21(23)20-13-12-16(15-22-20)14-19(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-13,15,19H,14H2,1H3 |
| InChIKey | PKCIUHRXORKVMB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |