C14H11F2NO2 — CID 139512431
methyl 5-[(3,4-difluorophenyl)methyl]pyridine-2-carboxylate (PubChem CID 139512431) has the molecular formula C14H11F2NO2 and a molecular weight of 263.24 g/mol. Its IUPAC name is methyl 5-[(3,4-difluorophenyl)methyl]pyridine-2-carboxylate.
| Compound Name | methyl 5-[(3,4-difluorophenyl)methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 139512431 |
| Molecular Formula | C14H11F2NO2 |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | methyl 5-[(3,4-difluorophenyl)methyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(Cc2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C14H11F2NO2/c1-19-14(18)13-5-3-10(8-17-13)6-9-2-4-11(15)12(16)7-9/h2-5,7-8H,6H2,1H3 |
| InChIKey | GSIGADULZVAMRN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |