C12H20N2O3 — CID 142388735
ethane;methyl 5-[(2-hydroxyethylamino)methyl]pyridine-2-carboxylate (PubChem CID 142388735) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is ethane;methyl 5-[(2-hydroxyethylamino)methyl]pyridine-2-carboxylate.
| Compound Name | ethane;methyl 5-[(2-hydroxyethylamino)methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 142388735 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | ethane;methyl 5-[(2-hydroxyethylamino)methyl]pyridine-2-carboxylate |
| SMILES | CC.COC(=O)c1ccc(CNCCO)cn1 |
| InChI | InChI=1S/C10H14N2O3.C2H6/c1-15-10(14)9-3-2-8(7-12-9)6-11-4-5-13;1-2/h2-3,7,11,13H,4-6H2,1H3;1-2H3 |
| InChIKey | ALYZKIMEAYGYBQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|