C15H16ClN3O3 — CID 170056291
methyl 5-[[(3-chloro-2-methoxy-4-pyridinyl)methylamino]methyl]pyridine-2-carboxylate (PubChem CID 170056291) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is methyl 5-[[(3-chloro-2-methoxy-4-pyridinyl)methylamino]methyl]pyridine-2-carboxylate.
| Compound Name | methyl 5-[[(3-chloro-2-methoxy-4-pyridinyl)methylamino]methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 170056291 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | methyl 5-[[(3-chloro-2-methoxy-4-pyridinyl)methylamino]methyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(CNCc2ccnc(OC)c2Cl)cn1 |
| InChI | InChI=1S/C15H16ClN3O3/c1-21-14-13(16)11(5-6-18-14)9-17-7-10-3-4-12(19-8-10)15(20)22-2/h3-6,8,17H,7,9H2,1-2H3 |
| InChIKey | VXPJLSGEAPPTDU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |