About methyl 5-[[1-(2-chloro-3,4-dimethoxyphenyl)propylamino]methyl]pyridine-2-carboxylate
methyl 5-[[1-(2-chloro-3,4-dimethoxyphenyl)propylamino]methyl]pyridine-2-carboxylate (PubChem CID 166869395) has the molecular formula C19H23ClN2O4
and a molecular weight of 378.86 g/mol. Its IUPAC name is methyl 5-[[1-(2-chloro-3,4-dimethoxyphenyl)propylamino]methyl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[[1-(2-chloro-3,4-dimethoxyphenyl)propylamino]methyl]pyridine-2-carboxylate |
| PubChem CID | 166869395 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | methyl 5-[[1-(2-chloro-3,4-dimethoxyphenyl)propylamino]methyl]pyridine-2-carboxylate |
| SMILES | CCC(NCc1ccc(C(=O)OC)nc1)c1ccc(OC)c(OC)c1Cl |
| InChI | InChI=1S/C19H23ClN2O4/c1-5-14(13-7-9-16(24-2)18(25-3)17(13)20)21-10-12-6-8-15(22-11-12)19(23)26-4/h6-9,11,14,21H,5,10H2,1-4H3 |
| InChIKey | XTSGABZHQMBWLL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-[[1-(2-chloro-3,4-dimethoxyphenyl)propylamino]methyl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[1-(2-chloro-3,4-dimethoxyphenyl)propylamino]methyl]pyridine-2-carboxylate?
The IUPAC name of methyl 5-[[1-(2-chloro-3,4-dimethoxyphenyl)propylamino]methyl]pyridine-2-carboxylate (CID 166869395) is methyl 5-[[1-(2-chloro-3,4-dimethoxyphenyl)propylamino]methyl]pyridine-2-carboxylate.
What is the SMILES notation for methyl 5-[[1-(2-chloro-3,4-dimethoxyphenyl)propylamino]methyl]pyridine-2-carboxylate?
The canonical SMILES for methyl 5-[[1-(2-chloro-3,4-dimethoxyphenyl)propylamino]methyl]pyridine-2-carboxylate is CCC(NCc1ccc(C(=O)OC)nc1)c1ccc(OC)c(OC)c1Cl.
What is the InChIKey of methyl 5-[[1-(2-chloro-3,4-dimethoxyphenyl)propylamino]methyl]pyridine-2-carboxylate?
The InChIKey is XTSGABZHQMBWLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23ClN2O4/c1-5-14(13-7-9-16(24-2)18(25-3)17(13)20)21-10-12-6-8-15(22-11-12)19(23)26-4/h6-9,11,14,21H,5,10H2,1-4H3.
What are the key properties of methyl 5-[[1-(2-chloro-3,4-dimethoxyphenyl)propylamino]methyl]pyridine-2-carboxylate?
methyl 5-[[1-(2-chloro-3,4-dimethoxyphenyl)propylamino]methyl]pyridine-2-carboxylate has a molecular weight of 378.86 g/mol, XLogP of 3.78, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[1-(2-chloro-3,4-dimethoxyphenyl)propylamino]methyl]pyridine-2-carboxylate is sourced from PubChem (CID 166869395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).