About 5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine
5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine (PubChem CID 143473669) has the molecular formula C12H8F3N
and a molecular weight of 223.20 g/mol. Its IUPAC name is 5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine.
Molecular Properties
| Compound Name | 5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine |
| PubChem CID | 143473669 |
| Molecular Formula | C12H8F3N |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine |
| SMILES | Fc1ccc(Cc2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C12H8F3N/c13-10-3-1-8(6-11(10)14)5-9-2-4-12(15)16-7-9/h1-4,6-7H,5H2 |
| InChIKey | QIZFVZLZVOKULP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine?
The IUPAC name of 5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine (CID 143473669) is 5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine.
What is the SMILES notation for 5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine?
The canonical SMILES for 5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine is Fc1ccc(Cc2ccc(F)c(F)c2)cn1.
What is the InChIKey of 5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine?
The InChIKey is QIZFVZLZVOKULP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F3N/c13-10-3-1-8(6-11(10)14)5-9-2-4-12(15)16-7-9/h1-4,6-7H,5H2.
What are the key properties of 5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine?
5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine has a molecular weight of 223.20 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine is sourced from PubChem (CID 143473669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).