C12H8F3N — CID 143473669
5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine (PubChem CID 143473669) has the molecular formula C12H8F3N and a molecular weight of 223.20 g/mol. Its IUPAC name is 5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine.
| Compound Name | 5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine |
|---|---|
| PubChem CID | 143473669 |
| Molecular Formula | C12H8F3N |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 5-[(3,4-difluorophenyl)methyl]-2-fluoropyridine |
| SMILES | Fc1ccc(Cc2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C12H8F3N/c13-10-3-1-8(6-11(10)14)5-9-2-4-12(15)16-7-9/h1-4,6-7H,5H2 |
| InChIKey | QIZFVZLZVOKULP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|