C19H23NO2 — CID 15942014
3-[benzyl(but-3-enyl)amino]-4-butylcyclobut-3-ene-1,2-dione (PubChem CID 15942014) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-[benzyl(but-3-enyl)amino]-4-butylcyclobut-3-ene-1,2-dione.
| Compound Name | 3-[benzyl(but-3-enyl)amino]-4-butylcyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 15942014 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 3-[benzyl(but-3-enyl)amino]-4-butylcyclobut-3-ene-1,2-dione |
| SMILES | C=CCCN(Cc1ccccc1)c1c(CCCC)c(=O)c1=O |
| InChI | InChI=1S/C19H23NO2/c1-3-5-12-16-17(19(22)18(16)21)20(13-6-4-2)14-15-10-8-7-9-11-15/h4,7-11H,2-3,5-6,12-14H2,1H3 |
| InChIKey | JVMHBVPBLQZKJJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|