C34H29ClF4N4O6S2 — CID 159423887
3-amino-N-(3,4-difluorophenyl)-2,3-dihydro-1-benzothiophene-7-carboxamide;methyl carbonochloridate;methyl N-[7-[(3,4-difluorophenyl)carbamoyl]-2,3-dihydro-1-benzothiophen-3-yl]carbamate (PubChem CID 159423887) has the molecular formula C34H29ClF4N4O6S2 and a molecular weight of 765.21 g/mol. Its IUPAC name is 3-amino-N-(3,4-difluorophenyl)-2,3-dihydro-1-benzothiophene-7-carboxamide;methyl carbonochloridate;methyl N-[7-[(3,4-difluorophenyl)carbamoyl]-2,3-dihydro-1-benzothiophen-3-yl]carbamate.
| Compound Name | 3-amino-N-(3,4-difluorophenyl)-2,3-dihydro-1-benzothiophene-7-carboxamide;methyl carbonochloridate;methyl N-[7-[(3,4-difluorophenyl)carbamoyl]-2,3-dihydro-1-benzothiophen-3-yl]carbamate |
|---|---|
| PubChem CID | 159423887 |
| Molecular Formula | C34H29ClF4N4O6S2 |
| Molecular Weight | 765.21 g/mol |
| Exact Mass | 764.12 |
| IUPAC Name | 3-amino-N-(3,4-difluorophenyl)-2,3-dihydro-1-benzothiophene-7-carboxamide;methyl carbonochloridate;methyl N-[7-[(3,4-difluorophenyl)carbamoyl]-2,3-dihydro-1-benzothiophen-3-yl]carbamate |
| SMILES | COC(=O)Cl.COC(=O)NC1CSc2c(C(=O)Nc3ccc(F)c(F)c3)cccc21.NC1CSc2c(C(=O)Nc3ccc(F)c(F)c3)cccc21 |
| InChI | InChI=1S/C17H14F2N2O3S.C15H12F2N2OS.C2H3ClO2/c1-24-17(23)21-14-8-25-15-10(14)3-2-4-11(15)16(22)20-9-5-6-12(18)13(19)7-9;16-11-5-4-8(6-12(11)17)19-15(20)10-3-1-2-9-13(18)7-21-14(9)10;1-5-2(3)4/h2-7,14H,8H2,1H3,(H,20,22)(H,21,23);1-6,13H,7,18H2,(H,19,20);1H3 |
| InChIKey | LQCGTQIDRQPXEN-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.21 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|