C16H14ClFIN3OS — CID 159425412
6-chloro-3-[(1S)-1-[(3-fluoro-4-iodo-2-pyridinyl)amino]ethyl]-1H-quinolin-2-one;sulfane (PubChem CID 159425412) has the molecular formula C16H14ClFIN3OS and a molecular weight of 477.73 g/mol. Its IUPAC name is 6-chloro-3-[(1S)-1-[(3-fluoro-4-iodo-2-pyridinyl)amino]ethyl]-1H-quinolin-2-one;sulfane.
| Compound Name | 6-chloro-3-[(1S)-1-[(3-fluoro-4-iodo-2-pyridinyl)amino]ethyl]-1H-quinolin-2-one;sulfane |
|---|---|
| PubChem CID | 159425412 |
| Molecular Formula | C16H14ClFIN3OS |
| Molecular Weight | 477.73 g/mol |
| Exact Mass | 476.96 |
| IUPAC Name | 6-chloro-3-[(1S)-1-[(3-fluoro-4-iodo-2-pyridinyl)amino]ethyl]-1H-quinolin-2-one;sulfane |
| SMILES | C[C@H](Nc1nccc(I)c1F)c1cc2cc(Cl)ccc2[nH]c1=O.S |
| InChI | InChI=1S/C16H12ClFIN3O.H2S/c1-8(21-15-14(18)12(19)4-5-20-15)11-7-9-6-10(17)2-3-13(9)22-16(11)23;/h2-8H,1H3,(H,20,21)(H,22,23);1H2/t8-;/m0./s1 |
| InChIKey | LQHBYBZDYKALTO-QRPNPIFTSA-N |
| XLogP | 4.61 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.73 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|