C18H36N4O6 — CID 159426248
1,3-bis(ethoxymethyl)imidazolidin-2-one (PubChem CID 159426248) has the molecular formula C18H36N4O6 and a molecular weight of 404.51 g/mol. Its IUPAC name is 1,3-bis(ethoxymethyl)imidazolidin-2-one.
| Compound Name | 1,3-bis(ethoxymethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 159426248 |
| Molecular Formula | C18H36N4O6 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 1,3-bis(ethoxymethyl)imidazolidin-2-one |
| SMILES | CCOCN1CCN(COCC)C1=O.CCOCN1CCN(COCC)C1=O |
| InChI | InChI=1S/2C9H18N2O3/c2*1-3-13-7-10-5-6-11(9(10)12)8-14-4-2/h2*3-8H2,1-2H3 |
| InChIKey | LQJVKVCMKJRQGE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 84.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |