C10H19NO2S — CID 159433945
tert-butyl 4-amino-3,3-dimethyl-4-sulfanylidenebutanoate (PubChem CID 159433945) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is tert-butyl 4-amino-3,3-dimethyl-4-sulfanylidenebutanoate.
| Compound Name | tert-butyl 4-amino-3,3-dimethyl-4-sulfanylidenebutanoate |
|---|---|
| PubChem CID | 159433945 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | tert-butyl 4-amino-3,3-dimethyl-4-sulfanylidenebutanoate |
| SMILES | CC(C)(C)OC(=O)CC(C)(C)C(N)=S |
| InChI | InChI=1S/C10H19NO2S/c1-9(2,3)13-7(12)6-10(4,5)8(11)14/h6H2,1-5H3,(H2,11,14) |
| InChIKey | LRIGPORWASTJHO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|