C19H29NO4 — CID 159436231
methane;propan-2-yl 1-[4-[(2-methoxyacetyl)amino]phenyl]cyclopentane-1-carboxylate (PubChem CID 159436231) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is methane;propan-2-yl 1-[4-[(2-methoxyacetyl)amino]phenyl]cyclopentane-1-carboxylate.
| Compound Name | methane;propan-2-yl 1-[4-[(2-methoxyacetyl)amino]phenyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 159436231 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | methane;propan-2-yl 1-[4-[(2-methoxyacetyl)amino]phenyl]cyclopentane-1-carboxylate |
| SMILES | C.COCC(=O)Nc1ccc(C2(C(=O)OC(C)C)CCCC2)cc1 |
| InChI | InChI=1S/C18H25NO4.CH4/c1-13(2)23-17(21)18(10-4-5-11-18)14-6-8-15(9-7-14)19-16(20)12-22-3;/h6-9,13H,4-5,10-12H2,1-3H3,(H,19,20);1H4 |
| InChIKey | LRPNGECNUOYDQG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |