C22H30O7 — CID 159436775
[2-[2-(2-methoxy-1-phenylcyclopentyl)oxy-2-oxoethoxy]-2-oxoethyl] 2,2-dimethylbutanoate (PubChem CID 159436775) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is [2-[2-(2-methoxy-1-phenylcyclopentyl)oxy-2-oxoethoxy]-2-oxoethyl] 2,2-dimethylbutanoate.
| Compound Name | [2-[2-(2-methoxy-1-phenylcyclopentyl)oxy-2-oxoethoxy]-2-oxoethyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 159436775 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [2-[2-(2-methoxy-1-phenylcyclopentyl)oxy-2-oxoethoxy]-2-oxoethyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(=O)OCC(=O)OC1(c2ccccc2)CCCC1OC |
| InChI | InChI=1S/C22H30O7/c1-5-21(2,3)20(25)28-14-18(23)27-15-19(24)29-22(13-9-12-17(22)26-4)16-10-7-6-8-11-16/h6-8,10-11,17H,5,9,12-15H2,1-4H3 |
| InChIKey | AADRLDRIBAKHHK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|