C20H30O2 — CID 142519802
methyl 2-methyl-2-[(3-methyl-1-phenylcyclohexyl)methyl]butanoate (PubChem CID 142519802) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is methyl 2-methyl-2-[(3-methyl-1-phenylcyclohexyl)methyl]butanoate.
| Compound Name | methyl 2-methyl-2-[(3-methyl-1-phenylcyclohexyl)methyl]butanoate |
|---|---|
| PubChem CID | 142519802 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | methyl 2-methyl-2-[(3-methyl-1-phenylcyclohexyl)methyl]butanoate |
| SMILES | CCC(C)(CC1(c2ccccc2)CCCC(C)C1)C(=O)OC |
| InChI | InChI=1S/C20H30O2/c1-5-19(3,18(21)22-4)15-20(13-9-10-16(2)14-20)17-11-7-6-8-12-17/h6-8,11-12,16H,5,9-10,13-15H2,1-4H3 |
| InChIKey | QKSNLBXXOXBLOH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |