C21H30O3 — CID 163438106
tert-butyl 4-(2-oxoethyl)-4-phenylcyclooctane-1-carboxylate (PubChem CID 163438106) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is tert-butyl 4-(2-oxoethyl)-4-phenylcyclooctane-1-carboxylate.
| Compound Name | tert-butyl 4-(2-oxoethyl)-4-phenylcyclooctane-1-carboxylate |
|---|---|
| PubChem CID | 163438106 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | tert-butyl 4-(2-oxoethyl)-4-phenylcyclooctane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCCCC(CC=O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H30O3/c1-20(2,3)24-19(23)17-9-7-8-13-21(14-12-17,15-16-22)18-10-5-4-6-11-18/h4-6,10-11,16-17H,7-9,12-15H2,1-3H3 |
| InChIKey | AWFRLJXRNFWZDT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|