C25H38O — CID 143850311
ethane;(3-methylidenecyclohexyl)-(4-phenyl-4-propylcyclohexyl)methanone (PubChem CID 143850311) has the molecular formula C25H38O and a molecular weight of 354.58 g/mol. Its IUPAC name is ethane;(3-methylidenecyclohexyl)-(4-phenyl-4-propylcyclohexyl)methanone.
| Compound Name | ethane;(3-methylidenecyclohexyl)-(4-phenyl-4-propylcyclohexyl)methanone |
|---|---|
| PubChem CID | 143850311 |
| Molecular Formula | C25H38O |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | ethane;(3-methylidenecyclohexyl)-(4-phenyl-4-propylcyclohexyl)methanone |
| SMILES | C=C1CCCC(C(=O)C2CCC(CCC)(c3ccccc3)CC2)C1.CC |
| InChI | InChI=1S/C23H32O.C2H6/c1-3-14-23(21-10-5-4-6-11-21)15-12-19(13-16-23)22(24)20-9-7-8-18(2)17-20;1-2/h4-6,10-11,19-20H,2-3,7-9,12-17H2,1H3;1-2H3 |
| InChIKey | HMQOYAFWNLWYTJ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|