C31H52N2O4 — CID 143635764
tert-butyl N-[(1-formyl-4-phenylpiperidin-4-yl)methyl]-N-methylcarbamate;ethane;1-(1-methoxyethyl)-3-methylidenecyclohexane (PubChem CID 143635764) has the molecular formula C31H52N2O4 and a molecular weight of 516.77 g/mol. Its IUPAC name is tert-butyl N-[(1-formyl-4-phenylpiperidin-4-yl)methyl]-N-methylcarbamate;ethane;1-(1-methoxyethyl)-3-methylidenecyclohexane.
| Compound Name | tert-butyl N-[(1-formyl-4-phenylpiperidin-4-yl)methyl]-N-methylcarbamate;ethane;1-(1-methoxyethyl)-3-methylidenecyclohexane |
|---|---|
| PubChem CID | 143635764 |
| Molecular Formula | C31H52N2O4 |
| Molecular Weight | 516.77 g/mol |
| Exact Mass | 516.39 |
| IUPAC Name | tert-butyl N-[(1-formyl-4-phenylpiperidin-4-yl)methyl]-N-methylcarbamate;ethane;1-(1-methoxyethyl)-3-methylidenecyclohexane |
| SMILES | C=C1CCCC(C(C)OC)C1.CC.CN(CC1(c2ccccc2)CCN(C=O)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28N2O3.C10H18O.C2H6/c1-18(2,3)24-17(23)20(4)14-19(16-8-6-5-7-9-16)10-12-21(15-22)13-11-19;1-8-5-4-6-10(7-8)9(2)11-3;1-2/h5-9,15H,10-14H2,1-4H3;9-10H,1,4-7H2,2-3H3;1-2H3 |
| InChIKey | NXBNQYOEBLKPBY-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.77 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|