C28H38N2O5S — CID 137361447
tert-butyl 4-[[(4-formylphenyl)sulfonyl-(2-methylpropyl)amino]methyl]-4-phenylpiperidine-1-carboxylate (PubChem CID 137361447) has the molecular formula C28H38N2O5S and a molecular weight of 514.69 g/mol. Its IUPAC name is tert-butyl 4-[[(4-formylphenyl)sulfonyl-(2-methylpropyl)amino]methyl]-4-phenylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(4-formylphenyl)sulfonyl-(2-methylpropyl)amino]methyl]-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 137361447 |
| Molecular Formula | C28H38N2O5S |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | tert-butyl 4-[[(4-formylphenyl)sulfonyl-(2-methylpropyl)amino]methyl]-4-phenylpiperidine-1-carboxylate |
| SMILES | CC(C)CN(CC1(c2ccccc2)CCN(C(=O)OC(C)(C)C)CC1)S(=O)(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C28H38N2O5S/c1-22(2)19-30(36(33,34)25-13-11-23(20-31)12-14-25)21-28(24-9-7-6-8-10-24)15-17-29(18-16-28)26(32)35-27(3,4)5/h6-14,20,22H,15-19,21H2,1-5H3 |
| InChIKey | MPTZLCHVDYRMEE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|