About cyclohexane-1,3-dione;methanethioic S-acid
cyclohexane-1,3-dione;methanethioic S-acid (PubChem CID 159444776) has the molecular formula C7H10O3S
and a molecular weight of 174.22 g/mol. Its IUPAC name is cyclohexane-1,3-dione;methanethioic S-acid.
Molecular Properties
| Compound Name | cyclohexane-1,3-dione;methanethioic S-acid |
| PubChem CID | 159444776 |
| Molecular Formula | C7H10O3S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | cyclohexane-1,3-dione;methanethioic S-acid |
| SMILES | O=C1CCCC(=O)C1.O=CS |
| InChI | InChI=1S/C6H8O2.CH2OS/c7-5-2-1-3-6(8)4-5;2-1-3/h1-4H2;1H,(H,2,3) |
| InChIKey | LSPXTOOYGWJBNU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 51.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane-1,3-dione;methanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane-1,3-dione;methanethioic S-acid?
The IUPAC name of cyclohexane-1,3-dione;methanethioic S-acid (CID 159444776) is cyclohexane-1,3-dione;methanethioic S-acid.
What is the SMILES notation for cyclohexane-1,3-dione;methanethioic S-acid?
The canonical SMILES for cyclohexane-1,3-dione;methanethioic S-acid is O=C1CCCC(=O)C1.O=CS.
What is the InChIKey of cyclohexane-1,3-dione;methanethioic S-acid?
The InChIKey is LSPXTOOYGWJBNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2.CH2OS/c7-5-2-1-3-6(8)4-5;2-1-3/h1-4H2;1H,(H,2,3).
What are the key properties of cyclohexane-1,3-dione;methanethioic S-acid?
cyclohexane-1,3-dione;methanethioic S-acid has a molecular weight of 174.22 g/mol, XLogP of 0.81, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,3-dione;methanethioic S-acid is sourced from PubChem (CID 159444776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).