C30H59NO2 — CID 175027248
cyclohexane-1,3-dione;N,N-dioctyloctan-1-amine (PubChem CID 175027248) has the molecular formula C30H59NO2 and a molecular weight of 465.81 g/mol. Its IUPAC name is cyclohexane-1,3-dione;N,N-dioctyloctan-1-amine.
| Compound Name | cyclohexane-1,3-dione;N,N-dioctyloctan-1-amine |
|---|---|
| PubChem CID | 175027248 |
| Molecular Formula | C30H59NO2 |
| Molecular Weight | 465.81 g/mol |
| Exact Mass | 465.45 |
| IUPAC Name | cyclohexane-1,3-dione;N,N-dioctyloctan-1-amine |
| SMILES | CCCCCCCCN(CCCCCCCC)CCCCCCCC.O=C1CCCC(=O)C1 |
| InChI | InChI=1S/C24H51N.C6H8O2/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;7-5-2-1-3-6(8)4-5/h4-24H2,1-3H3;1-4H2 |
| InChIKey | CWCDILODURRZQQ-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.81 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|