C18H19N3O7 — CID 15944793
methyl 4-[[2-(pyridin-4-ylmethylamino)acetyl]amino]benzoate;oxalic acid (PubChem CID 15944793) has the molecular formula C18H19N3O7 and a molecular weight of 389.36 g/mol. Its IUPAC name is methyl 4-[[2-(pyridin-4-ylmethylamino)acetyl]amino]benzoate;oxalic acid.
| Compound Name | methyl 4-[[2-(pyridin-4-ylmethylamino)acetyl]amino]benzoate;oxalic acid |
|---|---|
| PubChem CID | 15944793 |
| Molecular Formula | C18H19N3O7 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | methyl 4-[[2-(pyridin-4-ylmethylamino)acetyl]amino]benzoate;oxalic acid |
| SMILES | COC(=O)c1ccc(NC(=O)CNCc2ccncc2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H17N3O3.C2H2O4/c1-22-16(21)13-2-4-14(5-3-13)19-15(20)11-18-10-12-6-8-17-9-7-12;3-1(4)2(5)6/h2-9,18H,10-11H2,1H3,(H,19,20);(H,3,4)(H,5,6) |
| InChIKey | QZWDNOPUFVBYPK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 154.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|