C23H30O14 — CID 159448034
bis(2-hydroxyethyl) 6-oxopyran-2,4-dicarboxylate;methane;propyl 4-(1-hydroperoxyethyl)-6-oxopyran-2-carboxylate (PubChem CID 159448034) has the molecular formula C23H30O14 and a molecular weight of 530.48 g/mol. Its IUPAC name is bis(2-hydroxyethyl) 6-oxopyran-2,4-dicarboxylate;methane;propyl 4-(1-hydroperoxyethyl)-6-oxopyran-2-carboxylate.
| Compound Name | bis(2-hydroxyethyl) 6-oxopyran-2,4-dicarboxylate;methane;propyl 4-(1-hydroperoxyethyl)-6-oxopyran-2-carboxylate |
|---|---|
| PubChem CID | 159448034 |
| Molecular Formula | C23H30O14 |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | bis(2-hydroxyethyl) 6-oxopyran-2,4-dicarboxylate;methane;propyl 4-(1-hydroperoxyethyl)-6-oxopyran-2-carboxylate |
| SMILES | C.CCCOC(=O)c1cc(C(C)OO)cc(=O)o1.O=C(OCCO)c1cc(C(=O)OCCO)oc(=O)c1 |
| InChI | InChI=1S/C11H12O8.C11H14O6.CH4/c12-1-3-17-10(15)7-5-8(19-9(14)6-7)11(16)18-4-2-13;1-3-4-15-11(13)9-5-8(7(2)17-14)6-10(12)16-9;/h5-6,12-13H,1-4H2;5-7,14H,3-4H2,1-2H3;1H4 |
| InChIKey | LSZWIMCZTGVRCY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 209.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|