C12H14O8 — CID 20695351
propanoyloxymethyl 4-(1-hydroperoxyethyl)-6-oxopyran-2-carboxylate (PubChem CID 20695351) has the molecular formula C12H14O8 and a molecular weight of 286.24 g/mol. Its IUPAC name is propanoyloxymethyl 4-(1-hydroperoxyethyl)-6-oxopyran-2-carboxylate.
| Compound Name | propanoyloxymethyl 4-(1-hydroperoxyethyl)-6-oxopyran-2-carboxylate |
|---|---|
| PubChem CID | 20695351 |
| Molecular Formula | C12H14O8 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | propanoyloxymethyl 4-(1-hydroperoxyethyl)-6-oxopyran-2-carboxylate |
| SMILES | CCC(=O)OCOC(=O)c1cc(C(C)OO)cc(=O)o1 |
| InChI | InChI=1S/C12H14O8/c1-3-10(13)17-6-18-12(15)9-4-8(7(2)20-16)5-11(14)19-9/h4-5,7,16H,3,6H2,1-2H3 |
| InChIKey | JDHFLEQOGKTGCG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|