C22H26O16 — CID 160524824
bis(hydroxymethyl) 6-oxopyran-2,4-dicarboxylate;methane;propanoyloxymethyl 4-(1-hydroperoxyethyl)-6-oxopyran-2-carboxylate (PubChem CID 160524824) has the molecular formula C22H26O16 and a molecular weight of 546.43 g/mol. Its IUPAC name is bis(hydroxymethyl) 6-oxopyran-2,4-dicarboxylate;methane;propanoyloxymethyl 4-(1-hydroperoxyethyl)-6-oxopyran-2-carboxylate.
| Compound Name | bis(hydroxymethyl) 6-oxopyran-2,4-dicarboxylate;methane;propanoyloxymethyl 4-(1-hydroperoxyethyl)-6-oxopyran-2-carboxylate |
|---|---|
| PubChem CID | 160524824 |
| Molecular Formula | C22H26O16 |
| Molecular Weight | 546.43 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | bis(hydroxymethyl) 6-oxopyran-2,4-dicarboxylate;methane;propanoyloxymethyl 4-(1-hydroperoxyethyl)-6-oxopyran-2-carboxylate |
| SMILES | C.CCC(=O)OCOC(=O)c1cc(C(C)OO)cc(=O)o1.O=C(OCO)c1cc(C(=O)OCO)oc(=O)c1 |
| InChI | InChI=1S/C12H14O8.C9H8O8.CH4/c1-3-10(13)17-6-18-12(15)9-4-8(7(2)20-16)5-11(14)19-9;10-3-15-8(13)5-1-6(9(14)16-4-11)17-7(12)2-5;/h4-5,7,16H,3,6H2,1-2H3;1-2,10-11H,3-4H2;1H4 |
| InChIKey | QUTFMYFIQQRBAK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 235.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.43 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|