C20H24O12 — CID 91290525
4,6-diacetylpyran-2-one;ethyl 4-(1-hydroperoxyethyl)-6-oxopyran-2-carboxylate;methanediol (PubChem CID 91290525) has the molecular formula C20H24O12 and a molecular weight of 456.40 g/mol. Its IUPAC name is 4,6-diacetylpyran-2-one;ethyl 4-(1-hydroperoxyethyl)-6-oxopyran-2-carboxylate;methanediol.
| Compound Name | 4,6-diacetylpyran-2-one;ethyl 4-(1-hydroperoxyethyl)-6-oxopyran-2-carboxylate;methanediol |
|---|---|
| PubChem CID | 91290525 |
| Molecular Formula | C20H24O12 |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 4,6-diacetylpyran-2-one;ethyl 4-(1-hydroperoxyethyl)-6-oxopyran-2-carboxylate;methanediol |
| SMILES | CC(=O)c1cc(C(C)=O)oc(=O)c1.CCOC(=O)c1cc(C(C)OO)cc(=O)o1.OCO |
| InChI | InChI=1S/C10H12O6.C9H8O4.CH4O2/c1-3-14-10(12)8-4-7(6(2)16-13)5-9(11)15-8;1-5(10)7-3-8(6(2)11)13-9(12)4-7;2-1-3/h4-6,13H,3H2,1-2H3;3-4H,1-2H3;2-3H,1H2 |
| InChIKey | DWGMWAVPAOHGRX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 190.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|