C33H23FN2O3 — CID 15944915
(2'S,3S,3'S,10'bR)-3'-benzoyl-2'-(4-fluorobenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one (PubChem CID 15944915) has the molecular formula C33H23FN2O3 and a molecular weight of 514.56 g/mol. Its IUPAC name is (2'S,3S,3'S,10'bR)-3'-benzoyl-2'-(4-fluorobenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one.
| Compound Name | (2'S,3S,3'S,10'bR)-3'-benzoyl-2'-(4-fluorobenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
|---|---|
| PubChem CID | 15944915 |
| Molecular Formula | C33H23FN2O3 |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | (2'S,3S,3'S,10'bR)-3'-benzoyl-2'-(4-fluorobenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@@H](C(=O)c2ccc(F)cc2)[C@@]2(C(=O)Nc3ccccc32)[C@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C33H23FN2O3/c34-23-16-14-22(15-17-23)29(37)27-28(30(38)21-9-2-1-3-10-21)36-19-18-20-8-4-5-11-24(20)31(36)33(27)25-12-6-7-13-26(25)35-32(33)39/h1-19,27-28,31H,(H,35,39)/t27-,28-,31+,33+/m0/s1 |
| InChIKey | KIEFKOUVRUJWSL-TVNXZVQQSA-N |
| XLogP | 5.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |