C34H29N3O3 — CID 4891810
CID 4891810 (PubChem CID 4891810) has the molecular formula C34H29N3O3 and a molecular weight of 527.62 g/mol.
| Compound Name | CID 4891810 |
|---|---|
| PubChem CID | 4891810 |
| Molecular Formula | C34H29N3O3 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | — |
| SMILES | CCc1cccc2c1NC(=O)C21N2CCCC2C(C(=O)c2ccc3ccccc3c2)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C34H29N3O3/c1-2-20-11-7-13-25-29(20)36-32(40)34(25)33(24-12-5-6-14-26(24)35-31(33)39)28(27-15-8-18-37(27)34)30(38)23-17-16-21-9-3-4-10-22(21)19-23/h3-7,9-14,16-17,19,27-28H,2,8,15,18H2,1H3,(H,35,39)(H,36,40) |
| InChIKey | QYQDPBFSISDNBS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |