C41H45N5O5 — CID 155544614
CID 155544614 (PubChem CID 155544614) has the molecular formula C41H45N5O5 and a molecular weight of 687.84 g/mol.
| Compound Name | CID 155544614 |
|---|---|
| PubChem CID | 155544614 |
| Molecular Formula | C41H45N5O5 |
| Molecular Weight | 687.84 g/mol |
| Exact Mass | 687.34 |
| IUPAC Name | — |
| SMILES | O=C1CCC(N2Cc3c(CCCCCNC(=O)[C@@H]4NC5(CCCCC5)[C@@]5(C(=O)Nc6ccccc65)[C@H]4c4ccccc4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C41H45N5O5/c47-33-21-20-32(36(48)44-33)46-25-29-26(16-12-17-28(29)38(46)50)13-6-2-11-24-42-37(49)35-34(27-14-4-1-5-15-27)41(40(45-35)22-9-3-10-23-40)30-18-7-8-19-31(30)43-39(41)51/h1,4-5,7-8,12,14-19,32,34-35,45H,2-3,6,9-11,13,20-25H2,(H,42,49)(H,43,51)(H,44,47,48)/t32?,34-,35+,41+/m0/s1 |
| InChIKey | CBIIRFKVIVUUEB-UWGISFBZSA-N |
| XLogP | 4.63 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.84 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|