C40H43F5O7S2 — CID 159450542
1,1-difluoro-6-[2-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenoxy]carbonylprop-2-enoxy]hexane-1-sulfonate;tris(4-methylphenyl)sulfanium (PubChem CID 159450542) has the molecular formula C40H43F5O7S2 and a molecular weight of 794.90 g/mol. Its IUPAC name is 1,1-difluoro-6-[2-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenoxy]carbonylprop-2-enoxy]hexane-1-sulfonate;tris(4-methylphenyl)sulfanium.
| Compound Name | 1,1-difluoro-6-[2-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenoxy]carbonylprop-2-enoxy]hexane-1-sulfonate;tris(4-methylphenyl)sulfanium |
|---|---|
| PubChem CID | 159450542 |
| Molecular Formula | C40H43F5O7S2 |
| Molecular Weight | 794.90 g/mol |
| Exact Mass | 794.24 |
| IUPAC Name | 1,1-difluoro-6-[2-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenoxy]carbonylprop-2-enoxy]hexane-1-sulfonate;tris(4-methylphenyl)sulfanium |
| SMILES | C=C(COCCCCCC(F)(F)S(=O)(=O)[O-])C(=O)Oc1ccc(C(C)(O)C(F)(F)F)cc1.Cc1ccc([S+](c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H21S.C19H23F5O7S/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21;1-13(12-30-11-5-3-4-10-18(20,21)32(27,28)29)16(25)31-15-8-6-14(7-9-15)17(2,26)19(22,23)24/h4-15H,1-3H3;6-9,26H,1,3-5,10-12H2,2H3,(H,27,28,29)/q+1;/p-1 |
| InChIKey | LTHWUDWZDBUXMV-UHFFFAOYSA-M |
| XLogP | 9.34 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.90 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|