C10H8FN2NaO5S — CID 159450829
sodium (8-fluoro-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl) sulfate (PubChem CID 159450829) has the molecular formula C10H8FN2NaO5S and a molecular weight of 310.24 g/mol. Its IUPAC name is sodium (8-fluoro-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl) sulfate.
| Compound Name | sodium (8-fluoro-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl) sulfate |
|---|---|
| PubChem CID | 159450829 |
| Molecular Formula | C10H8FN2NaO5S |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | sodium (8-fluoro-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl) sulfate |
| SMILES | O=C1N2CC(c3ccccc3C2F)N1OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H9FN2O5S.Na/c11-9-7-4-2-1-3-6(7)8-5-12(9)10(14)13(8)18-19(15,16)17;/h1-4,8-9H,5H2,(H,15,16,17);/q;+1/p-1 |
| InChIKey | DMYBNEPCAXIDBE-UHFFFAOYSA-M |
| XLogP | -2.16 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|