C11H10N3NaO6S — CID 23692636
sodium [(1S,8S)-8-carbamoyl-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] sulfate (PubChem CID 23692636) has the molecular formula C11H10N3NaO6S and a molecular weight of 335.27 g/mol. Its IUPAC name is sodium [(1S,8S)-8-carbamoyl-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] sulfate.
| Compound Name | sodium [(1S,8S)-8-carbamoyl-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] sulfate |
|---|---|
| PubChem CID | 23692636 |
| Molecular Formula | C11H10N3NaO6S |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | sodium [(1S,8S)-8-carbamoyl-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] sulfate |
| SMILES | NC(=O)[C@@H]1c2ccccc2[C@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C11H11N3O6S.Na/c12-10(15)9-7-4-2-1-3-6(7)8-5-13(9)11(16)14(8)20-21(17,18)19;/h1-4,8-9H,5H2,(H2,12,15)(H,17,18,19);/q;+1/p-1/t8-,9+;/m1./s1 |
| InChIKey | YSDDCDHQSGPIPC-RJUBDTSPSA-M |
| XLogP | -3.60 |
| TPSA | 133.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|