C25H27ClN4O4 — CID 159461085
methyl 2-(4-benzylpiperazin-1-yl)pyridine-3-carboxylate;methyl 2-chloropyridine-3-carboxylate (PubChem CID 159461085) has the molecular formula C25H27ClN4O4 and a molecular weight of 482.97 g/mol. Its IUPAC name is methyl 2-(4-benzylpiperazin-1-yl)pyridine-3-carboxylate;methyl 2-chloropyridine-3-carboxylate.
| Compound Name | methyl 2-(4-benzylpiperazin-1-yl)pyridine-3-carboxylate;methyl 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 159461085 |
| Molecular Formula | C25H27ClN4O4 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | methyl 2-(4-benzylpiperazin-1-yl)pyridine-3-carboxylate;methyl 2-chloropyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1Cl.COC(=O)c1cccnc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H21N3O2.C7H6ClNO2/c1-23-18(22)16-8-5-9-19-17(16)21-12-10-20(11-13-21)14-15-6-3-2-4-7-15;1-11-7(10)5-3-2-4-9-6(5)8/h2-9H,10-14H2,1H3;2-4H,1H3 |
| InChIKey | LUPGQFSBBLJZPC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|