C16H19ClN2O — CID 159465894
N-(4-aminocyclohexyl)-5-chloro-1H-indene-2-carboxamide (PubChem CID 159465894) has the molecular formula C16H19ClN2O and a molecular weight of 290.79 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-5-chloro-1H-indene-2-carboxamide.
| Compound Name | N-(4-aminocyclohexyl)-5-chloro-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 159465894 |
| Molecular Formula | C16H19ClN2O |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-(4-aminocyclohexyl)-5-chloro-1H-indene-2-carboxamide |
| SMILES | NC1CCC(NC(=O)C2=Cc3cc(Cl)ccc3C2)CC1 |
| InChI | InChI=1S/C16H19ClN2O/c17-13-2-1-10-7-12(8-11(10)9-13)16(20)19-15-5-3-14(18)4-6-15/h1-2,8-9,14-15H,3-7,18H2,(H,19,20) |
| InChIKey | LVECYGGSIUYNQH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |