C41H43Cl2N11O4 — CID 159466050
N-[3-[4-amino-2-(4-morpholin-4-ylanilino)pyrido[3,4-d]pyrimidin-8-yl]phenyl]prop-2-enamide;tert-butyl N-(2-chloro-3-pyridinyl)carbamate;2-chloropyridin-3-amine (PubChem CID 159466050) has the molecular formula C41H43Cl2N11O4 and a molecular weight of 824.77 g/mol. Its IUPAC name is N-[3-[4-amino-2-(4-morpholin-4-ylanilino)pyrido[3,4-d]pyrimidin-8-yl]phenyl]prop-2-enamide;tert-butyl N-(2-chloro-3-pyridinyl)carbamate;2-chloropyridin-3-amine.
| Compound Name | N-[3-[4-amino-2-(4-morpholin-4-ylanilino)pyrido[3,4-d]pyrimidin-8-yl]phenyl]prop-2-enamide;tert-butyl N-(2-chloro-3-pyridinyl)carbamate;2-chloropyridin-3-amine |
|---|---|
| PubChem CID | 159466050 |
| Molecular Formula | C41H43Cl2N11O4 |
| Molecular Weight | 824.77 g/mol |
| Exact Mass | 823.29 |
| IUPAC Name | N-[3-[4-amino-2-(4-morpholin-4-ylanilino)pyrido[3,4-d]pyrimidin-8-yl]phenyl]prop-2-enamide;tert-butyl N-(2-chloro-3-pyridinyl)carbamate;2-chloropyridin-3-amine |
| SMILES | C=CC(=O)Nc1cccc(-c2nccc3c(N)nc(Nc4ccc(N5CCOCC5)cc4)nc23)c1.CC(C)(C)OC(=O)Nc1cccnc1Cl.Nc1cccnc1Cl |
| InChI | InChI=1S/C26H25N7O2.C10H13ClN2O2.C5H5ClN2/c1-2-22(34)29-19-5-3-4-17(16-19)23-24-21(10-11-28-23)25(27)32-26(31-24)30-18-6-8-20(9-7-18)33-12-14-35-15-13-33;1-10(2,3)15-9(14)13-7-5-4-6-12-8(7)11;6-5-4(7)2-1-3-8-5/h2-11,16H,1,12-15H2,(H,29,34)(H3,27,30,31,32);4-6H,1-3H3,(H,13,14);1-3H,7H2 |
| InChIKey | LVESCQOQWCJWBX-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 208.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.77 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|