C24H16N2O12S4 — CID 159467781
4,7-bis(4-sulfophenyl)-1,10-phenanthroline-2,3-disulfonic acid (PubChem CID 159467781) has the molecular formula C24H16N2O12S4 and a molecular weight of 652.66 g/mol. Its IUPAC name is 4,7-bis(4-sulfophenyl)-1,10-phenanthroline-2,3-disulfonic acid.
| Compound Name | 4,7-bis(4-sulfophenyl)-1,10-phenanthroline-2,3-disulfonic acid |
|---|---|
| PubChem CID | 159467781 |
| Molecular Formula | C24H16N2O12S4 |
| Molecular Weight | 652.66 g/mol |
| Exact Mass | 651.96 |
| IUPAC Name | 4,7-bis(4-sulfophenyl)-1,10-phenanthroline-2,3-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(-c2ccnc3c2ccc2c(-c4ccc(S(=O)(=O)O)cc4)c(S(=O)(=O)O)c(S(=O)(=O)O)nc23)cc1 |
| InChI | InChI=1S/C24H16N2O12S4/c27-39(28,29)15-5-1-13(2-6-15)17-11-12-25-21-18(17)9-10-19-20(14-3-7-16(8-4-14)40(30,31)32)23(41(33,34)35)24(26-22(19)21)42(36,37)38/h1-12H,(H,27,28,29)(H,30,31,32)(H,33,34,35)(H,36,37,38) |
| InChIKey | LVKHPSNOKMRKCP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 243.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.66 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|