C18H28N6O8S — CID 159468124
tert-butyl N-[1-[[(2S)-2-[5-[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octan-2-yl]-1,3,4-oxadiazol-2-yl]propyl]amino]ethenyl]carbamate (PubChem CID 159468124) has the molecular formula C18H28N6O8S and a molecular weight of 488.52 g/mol. Its IUPAC name is tert-butyl N-[1-[[(2S)-2-[5-[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octan-2-yl]-1,3,4-oxadiazol-2-yl]propyl]amino]ethenyl]carbamate.
| Compound Name | tert-butyl N-[1-[[(2S)-2-[5-[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octan-2-yl]-1,3,4-oxadiazol-2-yl]propyl]amino]ethenyl]carbamate |
|---|---|
| PubChem CID | 159468124 |
| Molecular Formula | C18H28N6O8S |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | tert-butyl N-[1-[[(2S)-2-[5-[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octan-2-yl]-1,3,4-oxadiazol-2-yl]propyl]amino]ethenyl]carbamate |
| SMILES | C=C(NC[C@H](C)c1nnc([C@@H]2CC[C@@H]3CN2C(=O)N3OS(=O)(=O)O)o1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N6O8S/c1-10(8-19-11(2)20-16(25)31-18(3,4)5)14-21-22-15(30-14)13-7-6-12-9-23(13)17(26)24(12)32-33(27,28)29/h10,12-13,19H,2,6-9H2,1,3-5H3,(H,20,25)(H,27,28,29)/t10-,12+,13-/m0/s1 |
| InChIKey | JOPOONWPQPBMRT-UHTWSYAYSA-N |
| XLogP | 1.43 |
| TPSA | 176.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|