methyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate

C10H16O4 — CID 15946863

IUPACmethyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate
SMILESCOC(=O)[C@@H]1CCC[C@]2(CCCO2)O1
InChIInChI=1S/C10H16O4/c1-12-9(11)8-4-2-5-10(14-8)6-3-7-13-10/h8H,2-7H2,1H3/t8-,10+/m0/s1
InChIKeyBKFSOWDSZFMYQT-WCBMZHEXSA-N
MW200.23 g/mol
LogP1.24
Rot. Bonds1

About methyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate

methyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate (PubChem CID 15946863) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is methyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate.

Molecular Properties

Compound Namemethyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate
PubChem CID15946863
Molecular FormulaC10H16O4
Molecular Weight200.23 g/mol
Exact Mass200.10
IUPAC Namemethyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate
SMILESCOC(=O)[C@@H]1CCC[C@]2(CCCO2)O1
InChIInChI=1S/C10H16O4/c1-12-9(11)8-4-2-5-10(14-8)6-3-7-13-10/h8H,2-7H2,1H3/t8-,10+/m0/s1
InChIKeyBKFSOWDSZFMYQT-WCBMZHEXSA-N
XLogP1.24
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.23
LogP ≤ 51.24
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate?
The IUPAC name of methyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate (CID 15946863) is methyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate.
What is the SMILES notation for methyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate?
The canonical SMILES for methyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate is COC(=O)[C@@H]1CCC[C@]2(CCCO2)O1.
What is the InChIKey of methyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate?
The InChIKey is BKFSOWDSZFMYQT-WCBMZHEXSA-N. The full InChI is InChI=1S/C10H16O4/c1-12-9(11)8-4-2-5-10(14-8)6-3-7-13-10/h8H,2-7H2,1H3/t8-,10+/m0/s1.
What are the key properties of methyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate?
methyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate has a molecular weight of 200.23 g/mol, XLogP of 1.24, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (5R,7S)-1,6-dioxaspiro[4.5]decane-7-carboxylate is sourced from PubChem (CID 15946863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).