C15H26O4 — CID 134858310
(1S,6S,12R)-6,14,14-trimethyl-5,13,15-trioxabicyclo[10.3.0]pentadecan-4-one (PubChem CID 134858310) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1S,6S,12R)-6,14,14-trimethyl-5,13,15-trioxabicyclo[10.3.0]pentadecan-4-one.
| Compound Name | (1S,6S,12R)-6,14,14-trimethyl-5,13,15-trioxabicyclo[10.3.0]pentadecan-4-one |
|---|---|
| PubChem CID | 134858310 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (1S,6S,12R)-6,14,14-trimethyl-5,13,15-trioxabicyclo[10.3.0]pentadecan-4-one |
| SMILES | C[C@H]1CCCCC[C@H]2OC(C)(C)O[C@H]2CCC(=O)O1 |
| InChI | InChI=1S/C15H26O4/c1-11-7-5-4-6-8-12-13(9-10-14(16)17-11)19-15(2,3)18-12/h11-13H,4-10H2,1-3H3/t11-,12+,13-/m0/s1 |
| InChIKey | FAGYCRXUSXLIID-XQQFMLRXSA-N |
| XLogP | 3.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |