C13H22O6 — CID 139249789
(2R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethoxyoxane-2-carbaldehyde (PubChem CID 139249789) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is (2R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethoxyoxane-2-carbaldehyde.
| Compound Name | (2R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethoxyoxane-2-carbaldehyde |
|---|---|
| PubChem CID | 139249789 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (2R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethoxyoxane-2-carbaldehyde |
| SMILES | COC1(OC)C[C@@H]([C@H]2COC(C)(C)O2)O[C@@H](C=O)C1 |
| InChI | InChI=1S/C13H22O6/c1-12(2)17-8-11(19-12)10-6-13(15-3,16-4)5-9(7-14)18-10/h7,9-11H,5-6,8H2,1-4H3/t9-,10+,11-/m1/s1 |
| InChIKey | ILQFRZNZKCBXSP-OUAUKWLOSA-N |
| XLogP | 0.87 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|