C33H34Cl4N2O3 — CID 159469211
(4R)-4-amino-1-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-ol;(1R)-4-(3,4-dichlorophenyl)-4-hydroperoxy-2,3-dihydro-1H-naphthalen-1-amine;methane (PubChem CID 159469211) has the molecular formula C33H34Cl4N2O3 and a molecular weight of 648.46 g/mol. Its IUPAC name is (4R)-4-amino-1-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-ol;(1R)-4-(3,4-dichlorophenyl)-4-hydroperoxy-2,3-dihydro-1H-naphthalen-1-amine;methane.
| Compound Name | (4R)-4-amino-1-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-ol;(1R)-4-(3,4-dichlorophenyl)-4-hydroperoxy-2,3-dihydro-1H-naphthalen-1-amine;methane |
|---|---|
| PubChem CID | 159469211 |
| Molecular Formula | C33H34Cl4N2O3 |
| Molecular Weight | 648.46 g/mol |
| Exact Mass | 646.13 |
| IUPAC Name | (4R)-4-amino-1-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-ol;(1R)-4-(3,4-dichlorophenyl)-4-hydroperoxy-2,3-dihydro-1H-naphthalen-1-amine;methane |
| SMILES | C.N[C@@H]1CCC(O)(c2ccc(Cl)c(Cl)c2)c2ccccc21.N[C@@H]1CCC(OO)(c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C16H15Cl2NO2.C16H15Cl2NO.CH4/c17-13-6-5-10(9-14(13)18)16(21-20)8-7-15(19)11-3-1-2-4-12(11)16;17-13-6-5-10(9-14(13)18)16(20)8-7-15(19)11-3-1-2-4-12(11)16;/h1-6,9,15,20H,7-8,19H2;1-6,9,15,20H,7-8,19H2;1H4/t2*15-,16?;/m11./s1 |
| InChIKey | LVOWBPMGDPNLRJ-UOSQALTRSA-N |
| XLogP | 9.18 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.46 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|