C18H24ClN5O2 — CID 159472120
5-chloro-N-[(3S,4R)-3-ethoxy-1-pyrimidin-2-ylpiperidin-4-yl]-4-ethyl-3H-pyrrole-2-carboxamide (PubChem CID 159472120) has the molecular formula C18H24ClN5O2 and a molecular weight of 377.88 g/mol. Its IUPAC name is 5-chloro-N-[(3S,4R)-3-ethoxy-1-pyrimidin-2-ylpiperidin-4-yl]-4-ethyl-3H-pyrrole-2-carboxamide.
| Compound Name | 5-chloro-N-[(3S,4R)-3-ethoxy-1-pyrimidin-2-ylpiperidin-4-yl]-4-ethyl-3H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 159472120 |
| Molecular Formula | C18H24ClN5O2 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 5-chloro-N-[(3S,4R)-3-ethoxy-1-pyrimidin-2-ylpiperidin-4-yl]-4-ethyl-3H-pyrrole-2-carboxamide |
| SMILES | CCO[C@H]1CN(c2ncccn2)CC[C@H]1NC(=O)C1=NC(Cl)=C(CC)C1 |
| InChI | InChI=1S/C18H24ClN5O2/c1-3-12-10-14(22-16(12)19)17(25)23-13-6-9-24(11-15(13)26-4-2)18-20-7-5-8-21-18/h5,7-8,13,15H,3-4,6,9-11H2,1-2H3,(H,23,25)/t13-,15+/m1/s1 |
| InChIKey | LVXZFTURNBUSOI-HIFRSBDPSA-N |
| XLogP | 2.28 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|