C20H23ClFN3O4 — CID 161218221
3-[(3S,4R)-4-[(5-chloro-4-ethyl-3H-pyrrole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-4-fluorobenzoic acid (PubChem CID 161218221) has the molecular formula C20H23ClFN3O4 and a molecular weight of 423.87 g/mol. Its IUPAC name is 3-[(3S,4R)-4-[(5-chloro-4-ethyl-3H-pyrrole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-4-fluorobenzoic acid.
| Compound Name | 3-[(3S,4R)-4-[(5-chloro-4-ethyl-3H-pyrrole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 161218221 |
| Molecular Formula | C20H23ClFN3O4 |
| Molecular Weight | 423.87 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 3-[(3S,4R)-4-[(5-chloro-4-ethyl-3H-pyrrole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-4-fluorobenzoic acid |
| SMILES | CCC1=C(Cl)N=C(C(=O)N[C@@H]2CCN(c3cc(C(=O)O)ccc3F)C[C@@H]2OC)C1 |
| InChI | InChI=1S/C20H23ClFN3O4/c1-3-11-8-15(23-18(11)21)19(26)24-14-6-7-25(10-17(14)29-2)16-9-12(20(27)28)4-5-13(16)22/h4-5,9,14,17H,3,6-8,10H2,1-2H3,(H,24,26)(H,27,28)/t14-,17+/m1/s1 |
| InChIKey | UXDTWMVEYOVJNC-PBHICJAKSA-N |
| XLogP | 2.94 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.87 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|