C21H39IN4O6S4 — CID 159474598
2-(2-aminoethyldisulfanyl)ethanamine;deuterio(iodo)methane;methyl 1-[2-[2-(4-methoxycarbonyl-2-oxopyrrolidin-1-yl)ethyldisulfanyl]ethyl]-5-oxopyrrolidine-3-carboxylate (PubChem CID 159474598) has the molecular formula C21H39IN4O6S4 and a molecular weight of 699.74 g/mol. Its IUPAC name is 2-(2-aminoethyldisulfanyl)ethanamine;deuterio(iodo)methane;methyl 1-[2-[2-(4-methoxycarbonyl-2-oxopyrrolidin-1-yl)ethyldisulfanyl]ethyl]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | 2-(2-aminoethyldisulfanyl)ethanamine;deuterio(iodo)methane;methyl 1-[2-[2-(4-methoxycarbonyl-2-oxopyrrolidin-1-yl)ethyldisulfanyl]ethyl]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 159474598 |
| Molecular Formula | C21H39IN4O6S4 |
| Molecular Weight | 699.74 g/mol |
| Exact Mass | 699.09 |
| IUPAC Name | 2-(2-aminoethyldisulfanyl)ethanamine;deuterio(iodo)methane;methyl 1-[2-[2-(4-methoxycarbonyl-2-oxopyrrolidin-1-yl)ethyldisulfanyl]ethyl]-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(CCSSCCN2CC(C(=O)OC)CC2=O)C1.NCCSSCCN.[2H]CI |
| InChI | InChI=1S/C16H24N2O6S2.C4H12N2S2.CH3I/c1-23-15(21)11-7-13(19)17(9-11)3-5-25-26-6-4-18-10-12(8-14(18)20)16(22)24-2;5-1-3-7-8-4-2-6;1-2/h11-12H,3-10H2,1-2H3;1-6H2;1H3/i;;1D |
| InChIKey | LWFKVNXNIHSOBP-PRQZKWGPSA-N |
| XLogP | 1.75 |
| TPSA | 145.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.74 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|