C23H16ClN5O — CID 15948107
N-[3-(2-amino-6-chloroquinazolin-4-yl)phenyl]-1H-indole-7-carboxamide (PubChem CID 15948107) has the molecular formula C23H16ClN5O and a molecular weight of 413.87 g/mol. Its IUPAC name is N-[3-(2-amino-6-chloroquinazolin-4-yl)phenyl]-1H-indole-7-carboxamide.
| Compound Name | N-[3-(2-amino-6-chloroquinazolin-4-yl)phenyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 15948107 |
| Molecular Formula | C23H16ClN5O |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-[3-(2-amino-6-chloroquinazolin-4-yl)phenyl]-1H-indole-7-carboxamide |
| SMILES | Nc1nc(-c2cccc(NC(=O)c3cccc4cc[nH]c34)c2)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C23H16ClN5O/c24-15-7-8-19-18(12-15)21(29-23(25)28-19)14-4-1-5-16(11-14)27-22(30)17-6-2-3-13-9-10-26-20(13)17/h1-12,26H,(H,27,30)(H2,25,28,29) |
| InChIKey | UHJAYQZRFHZQQW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |