C12H25F3N+ — CID 159481816
diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium;methane (PubChem CID 159481816) has the molecular formula C12H25F3N+ and a molecular weight of 240.33 g/mol. Its IUPAC name is diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium;methane.
| Compound Name | diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium;methane |
|---|---|
| PubChem CID | 159481816 |
| Molecular Formula | C12H25F3N+ |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium;methane |
| SMILES | C.CC[N+](C)(CC)CC=CCCC(F)(F)F |
| InChI | InChI=1S/C11H21F3N.CH4/c1-4-15(3,5-2)10-8-6-7-9-11(12,13)14;/h6,8H,4-5,7,9-10H2,1-3H3;1H4/q+1; |
| InChIKey | NHHSLJFCKUHVQL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|