C35H31N — CID 159484807
4-tert-butyl-3,9-diphenyl-5-(2,3,4,6-tetradeuterio-5-methylphenyl)carbazole (PubChem CID 159484807) has the molecular formula C35H31N and a molecular weight of 469.66 g/mol. Its IUPAC name is 4-tert-butyl-3,9-diphenyl-5-(2,3,4,6-tetradeuterio-5-methylphenyl)carbazole.
| Compound Name | 4-tert-butyl-3,9-diphenyl-5-(2,3,4,6-tetradeuterio-5-methylphenyl)carbazole |
|---|---|
| PubChem CID | 159484807 |
| Molecular Formula | C35H31N |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 4-tert-butyl-3,9-diphenyl-5-(2,3,4,6-tetradeuterio-5-methylphenyl)carbazole |
| SMILES | [2H]c1c([2H])c(C)c([2H])c(-c2cccc3c2c2c(C(C)(C)C)c(-c4ccccc4)ccc2n3-c2ccccc2)c1[2H] |
| InChI | InChI=1S/C35H31N/c1-24-13-11-16-26(23-24)28-19-12-20-30-32(28)33-31(36(30)27-17-9-6-10-18-27)22-21-29(34(33)35(2,3)4)25-14-7-5-8-15-25/h5-23H,1-4H3/i11D,13D,16D,23D |
| InChIKey | LLESLJHCWBXTPC-SGFATKOJSA-N |
| XLogP | 9.72 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |